About CID 67605368
CID 67605368 (PubChem CID 67605368) has the molecular formula C17H16CaO3
and a molecular weight of 308.39 g/mol.
Molecular Properties
| Compound Name | CID 67605368 |
| PubChem CID | 67605368 |
| Molecular Formula | C17H16CaO3 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)c1cccc2c1Cc1ccccc1O2.[Ca] |
| InChI | InChI=1S/C17H16O3.Ca/c1-11(2)19-17(18)13-7-5-9-16-14(13)10-12-6-3-4-8-15(12)20-16;/h3-9,11H,10H2,1-2H3; |
| InChIKey | IWEBEBAQSLSTPT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 67605368 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67605368?
The IUPAC name of CID 67605368 (CID 67605368) is not available.
What is the SMILES notation for CID 67605368?
The canonical SMILES for CID 67605368 is CC(C)OC(=O)c1cccc2c1Cc1ccccc1O2.[Ca].
What is the InChIKey of CID 67605368?
The InChIKey is IWEBEBAQSLSTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3.Ca/c1-11(2)19-17(18)13-7-5-9-16-14(13)10-12-6-3-4-8-15(12)20-16;/h3-9,11H,10H2,1-2H3;.
What are the key properties of CID 67605368?
CID 67605368 has a molecular weight of 308.39 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67605368 is sourced from PubChem (CID 67605368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).