C32H48O9S — CID 67605410
[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 67605410) has the molecular formula C32H48O9S and a molecular weight of 608.79 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67605410 |
| Molecular Formula | C32H48O9S |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@H](Sc2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H48O9S/c1-29(2,3)25(33)37-18-20-21(39-26(34)30(4,5)6)22(40-27(35)31(7,8)9)23(41-28(36)32(10,11)12)24(38-20)42-19-16-14-13-15-17-19/h13-17,20-24H,18H2,1-12H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | IJSPWMAKHRWCOT-GNADVCDUSA-N |
| XLogP | 5.97 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|