About 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole
5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole (PubChem CID 67605754) has the molecular formula C17H14Cl4N4
and a molecular weight of 416.14 g/mol. Its IUPAC name is 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole.
Molecular Properties
| Compound Name | 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole |
| PubChem CID | 67605754 |
| Molecular Formula | C17H14Cl4N4 |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole |
| SMILES | CCn1cnc2cc(Cl)c(Cl)cc21.Cn1cnc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C9H8Cl2N2.C8H6Cl2N2/c1-2-13-5-12-8-3-6(10)7(11)4-9(8)13;1-12-4-11-7-2-5(9)6(10)3-8(7)12/h3-5H,2H2,1H3;2-4H,1H3 |
| InChIKey | FUINYJMSMFHAPY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole?
The IUPAC name of 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole (CID 67605754) is 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole.
What is the SMILES notation for 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole?
The canonical SMILES for 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole is CCn1cnc2cc(Cl)c(Cl)cc21.Cn1cnc2cc(Cl)c(Cl)cc21.
What is the InChIKey of 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole?
The InChIKey is FUINYJMSMFHAPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2N2.C8H6Cl2N2/c1-2-13-5-12-8-3-6(10)7(11)4-9(8)13;1-12-4-11-7-2-5(9)6(10)3-8(7)12/h3-5H,2H2,1H3;2-4H,1H3.
What are the key properties of 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole?
5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole has a molecular weight of 416.14 g/mol, XLogP of 6.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-1-ethylbenzimidazole;5,6-dichloro-1-methylbenzimidazole is sourced from PubChem (CID 67605754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).