About N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine
N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine (PubChem CID 67605927) has the molecular formula C9H14N6
and a molecular weight of 206.25 g/mol. Its IUPAC name is N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine |
| PubChem CID | 67605927 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine |
| SMILES | NCCCN(c1ncc[nH]1)c1ncc[nH]1 |
| InChI | InChI=1S/C9H14N6/c10-2-1-7-15(8-11-3-4-12-8)9-13-5-6-14-9/h3-6H,1-2,7,10H2,(H,11,12)(H,13,14) |
| InChIKey | KABCLCGUQGHDMZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine?
The IUPAC name of N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine (CID 67605927) is N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine.
What is the SMILES notation for N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine?
The canonical SMILES for N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine is NCCCN(c1ncc[nH]1)c1ncc[nH]1.
What is the InChIKey of N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine?
The InChIKey is KABCLCGUQGHDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6/c10-2-1-7-15(8-11-3-4-12-8)9-13-5-6-14-9/h3-6H,1-2,7,10H2,(H,11,12)(H,13,14).
What are the key properties of N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine?
N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine has a molecular weight of 206.25 g/mol, XLogP of 0.62, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis(1H-imidazol-2-yl)propane-1,3-diamine is sourced from PubChem (CID 67605927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).