About [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate
[4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate (PubChem CID 67606034) has the molecular formula C19H20BrN3O3
and a molecular weight of 418.29 g/mol. Its IUPAC name is [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate.
Molecular Properties
| Compound Name | [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate |
| PubChem CID | 67606034 |
| Molecular Formula | C19H20BrN3O3 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Oc2ccc3c(nnn3CC(C)(C)C)c2Br)cc1 |
| InChI | InChI=1S/C19H20BrN3O3/c1-12(24)25-13-5-7-14(8-6-13)26-16-10-9-15-18(17(16)20)21-22-23(15)11-19(2,3)4/h5-10H,11H2,1-4H3 |
| InChIKey | YIJNAATXLBILGE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate?
The IUPAC name of [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate (CID 67606034) is [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate.
What is the SMILES notation for [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate?
The canonical SMILES for [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate is CC(=O)Oc1ccc(Oc2ccc3c(nnn3CC(C)(C)C)c2Br)cc1.
What is the InChIKey of [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate?
The InChIKey is YIJNAATXLBILGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrN3O3/c1-12(24)25-13-5-7-14(8-6-13)26-16-10-9-15-18(17(16)20)21-22-23(15)11-19(2,3)4/h5-10H,11H2,1-4H3.
What are the key properties of [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate?
[4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate has a molecular weight of 418.29 g/mol, XLogP of 4.96, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-bromo-1-(2,2-dimethylpropyl)benzotriazol-5-yl]oxyphenyl] acetate is sourced from PubChem (CID 67606034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).