C18H20N4O3 — CID 67606974
6-methyl-7-(3,4,5-trimethoxyphenyl)quinazoline-2,4-diamine (PubChem CID 67606974) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-methyl-7-(3,4,5-trimethoxyphenyl)quinazoline-2,4-diamine.
| Compound Name | 6-methyl-7-(3,4,5-trimethoxyphenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 67606974 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6-methyl-7-(3,4,5-trimethoxyphenyl)quinazoline-2,4-diamine |
| SMILES | COc1cc(-c2cc3nc(N)nc(N)c3cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H20N4O3/c1-9-5-12-13(21-18(20)22-17(12)19)8-11(9)10-6-14(23-2)16(25-4)15(7-10)24-3/h5-8H,1-4H3,(H4,19,20,21,22) |
| InChIKey | XNKZSTYYGUUJMG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |