C9H11FN2O2 — CID 67607149
(3aR,6aS)-5-cyano-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 67607149) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is (3aR,6aS)-5-cyano-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3aR,6aS)-5-cyano-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 67607149 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (3aR,6aS)-5-cyano-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | N#CC1(F)C[C@H]2CN(C(=O)O)C[C@H]2C1 |
| InChI | InChI=1S/C9H11FN2O2/c10-9(5-11)1-6-3-12(8(13)14)4-7(6)2-9/h6-7H,1-4H2,(H,13,14)/t6-,7+,9? |
| InChIKey | BVAQGMQKCNZUJY-AVSFMBPQSA-N |
| XLogP | 1.24 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |