About 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one
2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one (PubChem CID 67608124) has the molecular formula C17H14FNO4
and a molecular weight of 315.30 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one |
| PubChem CID | 67608124 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one |
| SMILES | CN(C)c1ccc(-c2cc(=O)c3c(F)cc(O)c(O)c3o2)cc1 |
| InChI | InChI=1S/C17H14FNO4/c1-19(2)10-5-3-9(4-6-10)14-8-12(20)15-11(18)7-13(21)16(22)17(15)23-14/h3-8,21-22H,1-2H3 |
| InChIKey | CTICYRQLUBBVSD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one?
The IUPAC name of 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one (CID 67608124) is 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one.
What is the SMILES notation for 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one?
The canonical SMILES for 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one is CN(C)c1ccc(-c2cc(=O)c3c(F)cc(O)c(O)c3o2)cc1.
What is the InChIKey of 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one?
The InChIKey is CTICYRQLUBBVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FNO4/c1-19(2)10-5-3-9(4-6-10)14-8-12(20)15-11(18)7-13(21)16(22)17(15)23-14/h3-8,21-22H,1-2H3.
What are the key properties of 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one?
2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one has a molecular weight of 315.30 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenyl]-5-fluoro-7,8-dihydroxychromen-4-one is sourced from PubChem (CID 67608124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).