About 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide
3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide (PubChem CID 67608207) has the molecular formula C12H13F2N3O2
and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide.
Molecular Properties
| Compound Name | 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide |
| PubChem CID | 67608207 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(C2(CF)COCC(N)=N2)c1 |
| InChI | InChI=1S/C12H13F2N3O2/c13-5-12(6-19-4-10(15)17-12)8-3-7(11(16)18)1-2-9(8)14/h1-3H,4-6H2,(H2,15,17)(H2,16,18) |
| InChIKey | OWAFKULVWUKJRL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide?
The IUPAC name of 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide (CID 67608207) is 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide.
What is the SMILES notation for 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide?
The canonical SMILES for 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide is NC(=O)c1ccc(F)c(C2(CF)COCC(N)=N2)c1.
What is the InChIKey of 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide?
The InChIKey is OWAFKULVWUKJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3O2/c13-5-12(6-19-4-10(15)17-12)8-3-7(11(16)18)1-2-9(8)14/h1-3H,4-6H2,(H2,15,17)(H2,16,18).
What are the key properties of 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide?
3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide has a molecular weight of 269.25 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-amino-3-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]-4-fluorobenzamide is sourced from PubChem (CID 67608207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).