About 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine
5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 67608212) has the molecular formula C11H13F2N3O
and a molecular weight of 241.24 g/mol. Its IUPAC name is 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine.
Molecular Properties
| Compound Name | 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine |
| PubChem CID | 67608212 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | NC1=NC(CF)(c2cc(N)ccc2F)COC1 |
| InChI | InChI=1S/C11H13F2N3O/c12-5-11(6-17-4-10(15)16-11)8-3-7(14)1-2-9(8)13/h1-3H,4-6,14H2,(H2,15,16) |
| InChIKey | ZNEMANYHKYMRAO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine?
The IUPAC name of 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine (CID 67608212) is 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine.
What is the SMILES notation for 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine?
The canonical SMILES for 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine is NC1=NC(CF)(c2cc(N)ccc2F)COC1.
What is the InChIKey of 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine?
The InChIKey is ZNEMANYHKYMRAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N3O/c12-5-11(6-17-4-10(15)16-11)8-3-7(14)1-2-9(8)13/h1-3H,4-6,14H2,(H2,15,16).
What are the key properties of 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine?
5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine has a molecular weight of 241.24 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine is sourced from PubChem (CID 67608212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).