C23H27F2N3O — CID 67608231
2-(2-fluoroanilino)-1-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylethanone (PubChem CID 67608231) has the molecular formula C23H27F2N3O and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(2-fluoroanilino)-1-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylethanone.
| Compound Name | 2-(2-fluoroanilino)-1-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 67608231 |
| Molecular Formula | C23H27F2N3O |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(2-fluoroanilino)-1-[(2S)-2-(2-fluorophenyl)pyrrolidin-1-yl]-2-piperidin-1-ylethanone |
| SMILES | O=C(C(Nc1ccccc1F)N1CCCCC1)N1CCC[C@H]1c1ccccc1F |
| InChI | InChI=1S/C23H27F2N3O/c24-18-10-3-2-9-17(18)21-13-8-16-28(21)23(29)22(27-14-6-1-7-15-27)26-20-12-5-4-11-19(20)25/h2-5,9-12,21-22,26H,1,6-8,13-16H2/t21-,22?/m0/s1 |
| InChIKey | OBPXWSWFQJUKHK-HMTLIYDFSA-N |
| XLogP | 4.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |