About 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one
4a,10a-dihydrochromeno[3,2-c]pyridin-10-one (PubChem CID 67608313) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one.
Molecular Properties
| Compound Name | 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one |
| PubChem CID | 67608313 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one |
| SMILES | O=C1c2ccccc2OC2C=CN=CC12 |
| InChI | InChI=1S/C12H9NO2/c14-12-8-3-1-2-4-10(8)15-11-5-6-13-7-9(11)12/h1-7,9,11H |
| InChIKey | VOFKAYRTTVLJPY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one?
The IUPAC name of 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one (CID 67608313) is 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one.
What is the SMILES notation for 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one?
The canonical SMILES for 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one is O=C1c2ccccc2OC2C=CN=CC12.
What is the InChIKey of 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one?
The InChIKey is VOFKAYRTTVLJPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-12-8-3-1-2-4-10(8)15-11-5-6-13-7-9(11)12/h1-7,9,11H.
What are the key properties of 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one?
4a,10a-dihydrochromeno[3,2-c]pyridin-10-one has a molecular weight of 199.21 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,10a-dihydrochromeno[3,2-c]pyridin-10-one is sourced from PubChem (CID 67608313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).