C12H14O2 — CID 67608971
2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromene (PubChem CID 67608971) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromene.
| Compound Name | 2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromene |
|---|---|
| PubChem CID | 67608971 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromene |
| SMILES | C1=CCC2OC3CCCOC3=CC2=C1 |
| InChI | InChI=1S/C12H14O2/c1-2-5-10-9(4-1)8-12-11(14-10)6-3-7-13-12/h1-2,4,8,10-11H,3,5-7H2 |
| InChIKey | DCVFLOHCGKSCHU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |