About (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide
(2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 67609073) has the molecular formula C16H20Cl2N2O2
and a molecular weight of 343.25 g/mol. Its IUPAC name is (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide |
| PubChem CID | 67609073 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CC(C)N1C(=O)CC[C@@]1(C)C(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-10(2)20-14(21)6-7-16(20,3)15(22)19-9-11-4-5-12(17)8-13(11)18/h4-5,8,10H,6-7,9H2,1-3H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | FLGXJSSGWNINOD-INIZCTEOSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide?
The IUPAC name of (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide (CID 67609073) is (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide is CC(C)N1C(=O)CC[C@@]1(C)C(=O)NCc1ccc(Cl)cc1Cl.
What is the InChIKey of (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide?
The InChIKey is FLGXJSSGWNINOD-INIZCTEOSA-N. The full InChI is InChI=1S/C16H20Cl2N2O2/c1-10(2)20-14(21)6-7-16(20,3)15(22)19-9-11-4-5-12(17)8-13(11)18/h4-5,8,10H,6-7,9H2,1-3H3,(H,19,22)/t16-/m0/s1.
What are the key properties of (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide?
(2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide has a molecular weight of 343.25 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(2,4-dichlorophenyl)methyl]-2-methyl-5-oxo-1-propan-2-ylpyrrolidine-2-carboxamide is sourced from PubChem (CID 67609073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).