C33H60O4Si — CID 67609466
(3S,5S,6S,10R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-17-[1-tri(propan-2-yl)silyloxypropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-ol (PubChem CID 67609466) has the molecular formula C33H60O4Si and a molecular weight of 548.93 g/mol. Its IUPAC name is (3S,5S,6S,10R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-17-[1-tri(propan-2-yl)silyloxypropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-ol.
| Compound Name | (3S,5S,6S,10R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-17-[1-tri(propan-2-yl)silyloxypropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-ol |
|---|---|
| PubChem CID | 67609466 |
| Molecular Formula | C33H60O4Si |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | (3S,5S,6S,10R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-17-[1-tri(propan-2-yl)silyloxypropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-ol |
| SMILES | COCO[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(C(C)CO[Si](C(C)C)(C(C)C)C(C)C)CC[C@H]4C3=C[C@H](O)[C@H]2C1 |
| InChI | InChI=1S/C33H60O4Si/c1-21(2)38(22(3)4,23(5)6)37-19-24(7)27-11-12-28-26-18-31(34)30-17-25(36-20-35-10)13-15-33(30,9)29(26)14-16-32(27,28)8/h18,21-25,27-31,34H,11-17,19-20H2,1-10H3/t24?,25-,27?,28-,29?,30+,31-,32+,33+/m0/s1 |
| InChIKey | PTMPQTMYQURSAY-QWFCJXJMSA-N |
| XLogP | 8.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|