C47H64N6 — CID 67609486
1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazine;1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-amine (PubChem CID 67609486) has the molecular formula C47H64N6 and a molecular weight of 713.07 g/mol. Its IUPAC name is 1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazine;1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-amine.
| Compound Name | 1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazine;1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 67609486 |
| Molecular Formula | C47H64N6 |
| Molecular Weight | 713.07 g/mol |
| Exact Mass | 712.52 |
| IUPAC Name | 1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazine;1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCC(N)CC4)n3)ccc21.CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCNCC4)n3)ccc21 |
| InChI | InChI=1S/C24H33N3.C23H31N3/c1-23(2)12-13-24(3,4)20-16-17(8-9-19(20)23)21-6-5-7-22(26-21)27-14-10-18(25)11-15-27;1-22(2)10-11-23(3,4)19-16-17(8-9-18(19)22)20-6-5-7-21(25-20)26-14-12-24-13-15-26/h5-9,16,18H,10-15,25H2,1-4H3;5-9,16,24H,10-15H2,1-4H3 |
| InChIKey | FBSBVUUZKVAHGL-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.07 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |