C14H15BrO4 — CID 67609604
(4aS,10aS)-8-bromo-2-(methoxymethyl)-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromen-10-one (PubChem CID 67609604) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol. Its IUPAC name is (4aS,10aS)-8-bromo-2-(methoxymethyl)-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromen-10-one.
| Compound Name | (4aS,10aS)-8-bromo-2-(methoxymethyl)-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromen-10-one |
|---|---|
| PubChem CID | 67609604 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | (4aS,10aS)-8-bromo-2-(methoxymethyl)-3,4,4a,10a-tetrahydro-2H-pyrano[3,2-b]chromen-10-one |
| SMILES | COCC1CC[C@@H]2Oc3ccc(Br)cc3C(=O)[C@H]2O1 |
| InChI | InChI=1S/C14H15BrO4/c1-17-7-9-3-5-12-14(18-9)13(16)10-6-8(15)2-4-11(10)19-12/h2,4,6,9,12,14H,3,5,7H2,1H3/t9?,12-,14-/m0/s1 |
| InChIKey | QKLXPKVUXLUOMN-AHHPIPEASA-N |
| XLogP | 2.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |