C29H32N8O2S — CID 67610088
4-N-(1-benzylindazol-5-yl)-6-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]pyrido[3,4-d]pyrimidine-4,6-diamine (PubChem CID 67610088) has the molecular formula C29H32N8O2S and a molecular weight of 556.70 g/mol. Its IUPAC name is 4-N-(1-benzylindazol-5-yl)-6-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]pyrido[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(1-benzylindazol-5-yl)-6-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]pyrido[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 67610088 |
| Molecular Formula | C29H32N8O2S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 4-N-(1-benzylindazol-5-yl)-6-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)butyl]pyrido[3,4-d]pyrimidine-4,6-diamine |
| SMILES | O=S1(=O)CCN(CCCCNc2cc3c(Nc4ccc5c(cnn5Cc5ccccc5)c4)ncnc3cn2)CC1 |
| InChI | InChI=1S/C29H32N8O2S/c38-40(39)14-12-36(13-15-40)11-5-4-10-30-28-17-25-26(19-31-28)32-21-33-29(25)35-24-8-9-27-23(16-24)18-34-37(27)20-22-6-2-1-3-7-22/h1-3,6-9,16-19,21H,4-5,10-15,20H2,(H,30,31)(H,32,33,35) |
| InChIKey | KKRPGPKCAKVGJX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|