C29H32F3N5O4 — CID 67610326
[1-[3-[4-(5-aminopentyl)-3-oxoquinoxalin-2-yl]indol-1-yl]-2-(diethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 67610326) has the molecular formula C29H32F3N5O4 and a molecular weight of 571.60 g/mol. Its IUPAC name is [1-[3-[4-(5-aminopentyl)-3-oxoquinoxalin-2-yl]indol-1-yl]-2-(diethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[3-[4-(5-aminopentyl)-3-oxoquinoxalin-2-yl]indol-1-yl]-2-(diethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67610326 |
| Molecular Formula | C29H32F3N5O4 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | [1-[3-[4-(5-aminopentyl)-3-oxoquinoxalin-2-yl]indol-1-yl]-2-(diethylamino)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | CCN(CC)C(=O)C(OC(=O)C(F)(F)F)n1cc(-c2nc3ccccc3n(CCCCCN)c2=O)c2ccccc21 |
| InChI | InChI=1S/C29H32F3N5O4/c1-3-35(4-2)26(39)27(41-28(40)29(30,31)32)37-18-20(19-12-6-8-14-22(19)37)24-25(38)36(17-11-5-10-16-33)23-15-9-7-13-21(23)34-24/h6-9,12-15,18,27H,3-5,10-11,16-17,33H2,1-2H3 |
| InChIKey | HREAMABQQVPOJH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|