About CID 67611787
CID 67611787 (PubChem CID 67611787) has the molecular formula C19H15OSi2
and a molecular weight of 315.50 g/mol.
Molecular Properties
| Compound Name | CID 67611787 |
| PubChem CID | 67611787 |
| Molecular Formula | C19H15OSi2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | — |
| SMILES | Cc1c([Si]O[Si])ccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H15OSi2/c1-14-18(22-20-21)13-12-17(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | KNKIVOOMUVEHBP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67611787 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67611787?
The IUPAC name of CID 67611787 (CID 67611787) is not available.
What is the SMILES notation for CID 67611787?
The canonical SMILES for CID 67611787 is Cc1c([Si]O[Si])ccc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of CID 67611787?
The InChIKey is KNKIVOOMUVEHBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15OSi2/c1-14-18(22-20-21)13-12-17(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3.
What are the key properties of CID 67611787?
CID 67611787 has a molecular weight of 315.50 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67611787 is sourced from PubChem (CID 67611787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).