C15H25N3 — CID 67612375
2-(1-propylpiperazin-2-yl)-1,3,3a,4-tetrahydroisoindole (PubChem CID 67612375) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 2-(1-propylpiperazin-2-yl)-1,3,3a,4-tetrahydroisoindole.
| Compound Name | 2-(1-propylpiperazin-2-yl)-1,3,3a,4-tetrahydroisoindole |
|---|---|
| PubChem CID | 67612375 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 2-(1-propylpiperazin-2-yl)-1,3,3a,4-tetrahydroisoindole |
| SMILES | CCCN1CCNCC1N1CC2=CC=CCC2C1 |
| InChI | InChI=1S/C15H25N3/c1-2-8-17-9-7-16-10-15(17)18-11-13-5-3-4-6-14(13)12-18/h3-5,14-16H,2,6-12H2,1H3 |
| InChIKey | IUSAQDHOQHZXEV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |