About N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide
N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide (PubChem CID 67612386) has the molecular formula C8H14F3N3O
and a molecular weight of 225.21 g/mol. Its IUPAC name is N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide |
| PubChem CID | 67612386 |
| Molecular Formula | C8H14F3N3O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O/c1-6(8(9,10)11)13-7(15)14-4-2-12-3-5-14/h6,12H,2-5H2,1H3,(H,13,15)/t6-/m1/s1 |
| InChIKey | VMOCLSDXURXIAW-ZCFIWIBFSA-N |
| XLogP | 0.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide?
The IUPAC name of N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide (CID 67612386) is N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide.
What is the SMILES notation for N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide?
The canonical SMILES for N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide is C[C@@H](NC(=O)N1CCNCC1)C(F)(F)F.
What is the InChIKey of N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide?
The InChIKey is VMOCLSDXURXIAW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14F3N3O/c1-6(8(9,10)11)13-7(15)14-4-2-12-3-5-14/h6,12H,2-5H2,1H3,(H,13,15)/t6-/m1/s1.
What are the key properties of N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide?
N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide has a molecular weight of 225.21 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1,1,1-trifluoropropan-2-yl]piperazine-1-carboxamide is sourced from PubChem (CID 67612386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).