About 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine
2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine (PubChem CID 67612831) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine.
Molecular Properties
| Compound Name | 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine |
| PubChem CID | 67612831 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine |
| SMILES | CON1C2CC3CC1(C)CC(C2)C3N |
| InChI | InChI=1S/C11H20N2O/c1-11-5-7-3-9(13(11)14-2)4-8(6-11)10(7)12/h7-10H,3-6,12H2,1-2H3 |
| InChIKey | INTBHZZGGUOUEQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine?
The IUPAC name of 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine (CID 67612831) is 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine.
What is the SMILES notation for 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine?
The canonical SMILES for 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine is CON1C2CC3CC1(C)CC(C2)C3N.
What is the InChIKey of 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine?
The InChIKey is INTBHZZGGUOUEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-11-5-7-3-9(13(11)14-2)4-8(6-11)10(7)12/h7-10H,3-6,12H2,1-2H3.
What are the key properties of 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine?
2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine has a molecular weight of 196.29 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-methyl-2-azatricyclo[3.3.1.13,7]decan-6-amine is sourced from PubChem (CID 67612831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).