C11H16N2O — CID 67612975
acetamide;1,2,3,4-tetrahydroisoquinoline (PubChem CID 67612975) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is acetamide;1,2,3,4-tetrahydroisoquinoline.
| Compound Name | acetamide;1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 67612975 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | acetamide;1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC(N)=O.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.C2H5NO/c1-2-4-9-7-10-6-5-8(9)3-1;1-2(3)4/h1-4,10H,5-7H2;1H3,(H2,3,4) |
| InChIKey | SIDCKBYOGVETMM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |