About (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone
(1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone (PubChem CID 67613124) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone |
| PubChem CID | 67613124 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cccc3c2CCC3N)cc1 |
| InChI | InChI=1S/C17H17NO/c1-11-5-7-12(8-6-11)17(19)15-4-2-3-14-13(15)9-10-16(14)18/h2-8,16H,9-10,18H2,1H3 |
| InChIKey | ADFNTOQIANWALM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone?
The IUPAC name of (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone (CID 67613124) is (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone.
What is the SMILES notation for (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone?
The canonical SMILES for (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone is Cc1ccc(C(=O)c2cccc3c2CCC3N)cc1.
What is the InChIKey of (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone?
The InChIKey is ADFNTOQIANWALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO/c1-11-5-7-12(8-6-11)17(19)15-4-2-3-14-13(15)9-10-16(14)18/h2-8,16H,9-10,18H2,1H3.
What are the key properties of (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone?
(1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone has a molecular weight of 251.33 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-2,3-dihydro-1H-inden-4-yl)-(4-methylphenyl)methanone is sourced from PubChem (CID 67613124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).