About [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol
[1,3-bis(hydroxymethyl)triazinan-5-yl]methanol (PubChem CID 67613318) has the molecular formula C6H15N3O3
and a molecular weight of 177.20 g/mol. Its IUPAC name is [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol.
Molecular Properties
| Compound Name | [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol |
| PubChem CID | 67613318 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol |
| SMILES | OCC1CN(CO)NN(CO)C1 |
| InChI | InChI=1S/C6H15N3O3/c10-3-6-1-8(4-11)7-9(2-6)5-12/h6-7,10-12H,1-5H2 |
| InChIKey | BLZGNXCJWFTEHN-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol?
The IUPAC name of [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol (CID 67613318) is [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol.
What is the SMILES notation for [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol?
The canonical SMILES for [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol is OCC1CN(CO)NN(CO)C1.
What is the InChIKey of [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol?
The InChIKey is BLZGNXCJWFTEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O3/c10-3-6-1-8(4-11)7-9(2-6)5-12/h6-7,10-12H,1-5H2.
What are the key properties of [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol?
[1,3-bis(hydroxymethyl)triazinan-5-yl]methanol has a molecular weight of 177.20 g/mol, XLogP of -2.47, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis(hydroxymethyl)triazinan-5-yl]methanol is sourced from PubChem (CID 67613318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).