About bis(prop-2-enyl)carbamic acid;piperazine
bis(prop-2-enyl)carbamic acid;piperazine (PubChem CID 67613409) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is bis(prop-2-enyl)carbamic acid;piperazine.
Molecular Properties
| Compound Name | bis(prop-2-enyl)carbamic acid;piperazine |
| PubChem CID | 67613409 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | bis(prop-2-enyl)carbamic acid;piperazine |
| SMILES | C1CNCCN1.C=CCN(CC=C)C(=O)O |
| InChI | InChI=1S/C7H11NO2.C4H10N2/c1-3-5-8(6-4-2)7(9)10;1-2-6-4-3-5-1/h3-4H,1-2,5-6H2,(H,9,10);5-6H,1-4H2 |
| InChIKey | YTLYXMCBSGQUAN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl)carbamic acid;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl)carbamic acid;piperazine?
The IUPAC name of bis(prop-2-enyl)carbamic acid;piperazine (CID 67613409) is bis(prop-2-enyl)carbamic acid;piperazine.
What is the SMILES notation for bis(prop-2-enyl)carbamic acid;piperazine?
The canonical SMILES for bis(prop-2-enyl)carbamic acid;piperazine is C1CNCCN1.C=CCN(CC=C)C(=O)O.
What is the InChIKey of bis(prop-2-enyl)carbamic acid;piperazine?
The InChIKey is YTLYXMCBSGQUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.C4H10N2/c1-3-5-8(6-4-2)7(9)10;1-2-6-4-3-5-1/h3-4H,1-2,5-6H2,(H,9,10);5-6H,1-4H2.
What are the key properties of bis(prop-2-enyl)carbamic acid;piperazine?
bis(prop-2-enyl)carbamic acid;piperazine has a molecular weight of 227.31 g/mol, XLogP of 0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl)carbamic acid;piperazine is sourced from PubChem (CID 67613409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).