About 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene
6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene (PubChem CID 67613479) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene.
Molecular Properties
| Compound Name | 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene |
| PubChem CID | 67613479 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene |
| SMILES | CCC1c2cnc1[nH]2 |
| InChI | InChI=1S/C6H8N2/c1-2-4-5-3-7-6(4)8-5/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | WKWBEZLBUREIJP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene?
The IUPAC name of 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene (CID 67613479) is 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene.
What is the SMILES notation for 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene?
The canonical SMILES for 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene is CCC1c2cnc1[nH]2.
What is the InChIKey of 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene?
The InChIKey is WKWBEZLBUREIJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-2-4-5-3-7-6(4)8-5/h3-4H,2H2,1H3,(H,7,8).
What are the key properties of 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene?
6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene has a molecular weight of 108.14 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,5-diazabicyclo[2.1.1]hexa-1,3-diene is sourced from PubChem (CID 67613479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).