About 1-methyl-5,6-dihydroindeno[2,1-b]indole
1-methyl-5,6-dihydroindeno[2,1-b]indole (PubChem CID 67613621) has the molecular formula C16H13N
and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-methyl-5,6-dihydroindeno[2,1-b]indole.
Molecular Properties
| Compound Name | 1-methyl-5,6-dihydroindeno[2,1-b]indole |
| PubChem CID | 67613621 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-methyl-5,6-dihydroindeno[2,1-b]indole |
| SMILES | Cc1cccc2[nH]c3c(c12)-c1ccccc1C3 |
| InChI | InChI=1S/C16H13N/c1-10-5-4-8-13-15(10)16-12-7-3-2-6-11(12)9-14(16)17-13/h2-8,17H,9H2,1H3 |
| InChIKey | UWEJTPSZSGYQDM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-5,6-dihydroindeno[2,1-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-dihydroindeno[2,1-b]indole?
The IUPAC name of 1-methyl-5,6-dihydroindeno[2,1-b]indole (CID 67613621) is 1-methyl-5,6-dihydroindeno[2,1-b]indole.
What is the SMILES notation for 1-methyl-5,6-dihydroindeno[2,1-b]indole?
The canonical SMILES for 1-methyl-5,6-dihydroindeno[2,1-b]indole is Cc1cccc2[nH]c3c(c12)-c1ccccc1C3.
What is the InChIKey of 1-methyl-5,6-dihydroindeno[2,1-b]indole?
The InChIKey is UWEJTPSZSGYQDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N/c1-10-5-4-8-13-15(10)16-12-7-3-2-6-11(12)9-14(16)17-13/h2-8,17H,9H2,1H3.
What are the key properties of 1-methyl-5,6-dihydroindeno[2,1-b]indole?
1-methyl-5,6-dihydroindeno[2,1-b]indole has a molecular weight of 219.29 g/mol, XLogP of 4.05, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-dihydroindeno[2,1-b]indole is sourced from PubChem (CID 67613621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).