About 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene
1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene (PubChem CID 67613878) has the molecular formula C22H24O
and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene.
Molecular Properties
| Compound Name | 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene |
| PubChem CID | 67613878 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene |
| SMILES | C=CC(C=C)OC(C=C)C=C.C=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10.C10H14O/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-5-9(6-2)11-10(7-3)8-4/h2-9H,1H2;5-10H,1-4H2 |
| InChIKey | YYGLNLGYEITWQH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene?
The IUPAC name of 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene (CID 67613878) is 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene.
What is the SMILES notation for 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene?
The canonical SMILES for 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene is C=CC(C=C)OC(C=C)C=C.C=Cc1cccc2ccccc12.
What is the InChIKey of 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene?
The InChIKey is YYGLNLGYEITWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H14O/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-5-9(6-2)11-10(7-3)8-4/h2-9H,1H2;5-10H,1-4H2.
What are the key properties of 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene?
1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene has a molecular weight of 304.43 g/mol, XLogP of 5.97, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylnaphthalene;3-penta-1,4-dien-3-yloxypenta-1,4-diene is sourced from PubChem (CID 67613878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).