C14H20N2O — CID 67614690
spiro[2,4a,5,6,7,7a-hexahydrofuro[2,3-f]indole-3,4'-piperidine] (PubChem CID 67614690) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is spiro[2,4a,5,6,7,7a-hexahydrofuro[2,3-f]indole-3,4'-piperidine].
| Compound Name | spiro[2,4a,5,6,7,7a-hexahydrofuro[2,3-f]indole-3,4'-piperidine] |
|---|---|
| PubChem CID | 67614690 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | spiro[2,4a,5,6,7,7a-hexahydrofuro[2,3-f]indole-3,4'-piperidine] |
| SMILES | C1=C2OCC3(CCNCC3)C2=CC2NCCC12 |
| InChI | InChI=1S/C14H20N2O/c1-4-16-12-8-11-13(7-10(1)12)17-9-14(11)2-5-15-6-3-14/h7-8,10,12,15-16H,1-6,9H2 |
| InChIKey | WPGVMWOIOOIZRD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |