About methanol;2-nitro-1H-imidazole
methanol;2-nitro-1H-imidazole (PubChem CID 67614962) has the molecular formula C4H7N3O3
and a molecular weight of 145.12 g/mol. Its IUPAC name is methanol;2-nitro-1H-imidazole.
Molecular Properties
| Compound Name | methanol;2-nitro-1H-imidazole |
| PubChem CID | 67614962 |
| Molecular Formula | C4H7N3O3 |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | methanol;2-nitro-1H-imidazole |
| SMILES | CO.O=[N+]([O-])c1ncc[nH]1 |
| InChI | InChI=1S/C3H3N3O2.CH4O/c7-6(8)3-4-1-2-5-3;1-2/h1-2H,(H,4,5);2H,1H3 |
| InChIKey | RWNLROQLOYUNTL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-nitro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-nitro-1H-imidazole?
The IUPAC name of methanol;2-nitro-1H-imidazole (CID 67614962) is methanol;2-nitro-1H-imidazole.
What is the SMILES notation for methanol;2-nitro-1H-imidazole?
The canonical SMILES for methanol;2-nitro-1H-imidazole is CO.O=[N+]([O-])c1ncc[nH]1.
What is the InChIKey of methanol;2-nitro-1H-imidazole?
The InChIKey is RWNLROQLOYUNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2.CH4O/c7-6(8)3-4-1-2-5-3;1-2/h1-2H,(H,4,5);2H,1H3.
What are the key properties of methanol;2-nitro-1H-imidazole?
methanol;2-nitro-1H-imidazole has a molecular weight of 145.12 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-nitro-1H-imidazole is sourced from PubChem (CID 67614962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).