C29H34F3N7O5 — CID 67615147
(2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-(2-naphthalen-2-ylacetyl)amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 67615147) has the molecular formula C29H34F3N7O5 and a molecular weight of 617.63 g/mol. Its IUPAC name is (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-(2-naphthalen-2-ylacetyl)amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-(2-naphthalen-2-ylacetyl)amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67615147 |
| Molecular Formula | C29H34F3N7O5 |
| Molecular Weight | 617.63 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | (2R)-2-[[4-[(carbamoylamino)methyl]phenyl]methyl-(2-naphthalen-2-ylacetyl)amino]-5-(diaminomethylideneamino)pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)NCc1ccc(CN(C(=O)Cc2ccc3ccccc3c2)[C@H](CCCN=C(N)N)C(N)=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H33N7O3.C2HF3O2/c28-25(36)23(6-3-13-32-26(29)30)34(17-19-9-7-18(8-10-19)16-33-27(31)37)24(35)15-20-11-12-21-4-1-2-5-22(21)14-20;3-2(4,5)1(6)7/h1-2,4-5,7-12,14,23H,3,6,13,15-17H2,(H2,28,36)(H4,29,30,32)(H3,31,33,37);(H,6,7)/t23-;/m1./s1 |
| InChIKey | GZRHKGLZKJYSIL-GNAFDRTKSA-N |
| XLogP | 2.12 |
| TPSA | 220.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|