C29H30Br2N4O4S2 — CID 67615316
N',1-bis[3-(4-aminophenyl)sulfonyl-5-bromophenyl]-N'-ethyl-N,N-dimethylmethanediamine (PubChem CID 67615316) has the molecular formula C29H30Br2N4O4S2 and a molecular weight of 722.53 g/mol. Its IUPAC name is N',1-bis[3-(4-aminophenyl)sulfonyl-5-bromophenyl]-N'-ethyl-N,N-dimethylmethanediamine.
| Compound Name | N',1-bis[3-(4-aminophenyl)sulfonyl-5-bromophenyl]-N'-ethyl-N,N-dimethylmethanediamine |
|---|---|
| PubChem CID | 67615316 |
| Molecular Formula | C29H30Br2N4O4S2 |
| Molecular Weight | 722.53 g/mol |
| Exact Mass | 720.01 |
| IUPAC Name | N',1-bis[3-(4-aminophenyl)sulfonyl-5-bromophenyl]-N'-ethyl-N,N-dimethylmethanediamine |
| SMILES | CCN(c1cc(Br)cc(S(=O)(=O)c2ccc(N)cc2)c1)C(c1cc(Br)cc(S(=O)(=O)c2ccc(N)cc2)c1)N(C)C |
| InChI | InChI=1S/C29H30Br2N4O4S2/c1-4-35(24-15-21(31)17-28(18-24)41(38,39)26-11-7-23(33)8-12-26)29(34(2)3)19-13-20(30)16-27(14-19)40(36,37)25-9-5-22(32)6-10-25/h5-18,29H,4,32-33H2,1-3H3 |
| InChIKey | GDSZKRWETAKIPR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|