C10H15ClN2O4S — CID 67615409
(2S)-2-amino-3-hydroxy-N-(4-methylsulfonylphenyl)propanamide;hydrochloride (PubChem CID 67615409) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy-N-(4-methylsulfonylphenyl)propanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3-hydroxy-N-(4-methylsulfonylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 67615409 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (2S)-2-amino-3-hydroxy-N-(4-methylsulfonylphenyl)propanamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)[C@@H](N)CO)cc1.Cl |
| InChI | InChI=1S/C10H14N2O4S.ClH/c1-17(15,16)8-4-2-7(3-5-8)12-10(14)9(11)6-13;/h2-5,9,13H,6,11H2,1H3,(H,12,14);1H/t9-;/m0./s1 |
| InChIKey | ALDBRMBPHQXCOX-FVGYRXGTSA-N |
| XLogP | -0.23 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |