C23H36N2O2 — CID 67615881
(3aS,3bS,9aS,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-9-carboxamide (PubChem CID 67615881) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-9-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-9-carboxamide |
|---|---|
| PubChem CID | 67615881 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (3aS,3bS,9aS,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-9-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC(=O)C=C2NC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C23H36N2O2/c1-21(2,3)25-20(27)18-11-14(26)12-19-23(18,5)17-8-10-22(4)9-6-7-16(22)15(17)13-24-19/h12,15-18,24H,6-11,13H2,1-5H3,(H,25,27)/t15-,16-,17-,18?,22-,23-/m0/s1 |
| InChIKey | GCSAWHBKEKIGDK-YFROGSFMSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |