C30H48O6 — CID 67615955
8-[(1R,3aR,5aS,7S,9aS,11aR)-7-(methoxymethoxy)-9a,11a-dimethyl-5-oxo-2,3,3a,5a,6,7,8,9,10,11-decahydro-1H-indeno[4,5-c]isochromen-1-yl]octyl acetate (PubChem CID 67615955) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is 8-[(1R,3aR,5aS,7S,9aS,11aR)-7-(methoxymethoxy)-9a,11a-dimethyl-5-oxo-2,3,3a,5a,6,7,8,9,10,11-decahydro-1H-indeno[4,5-c]isochromen-1-yl]octyl acetate.
| Compound Name | 8-[(1R,3aR,5aS,7S,9aS,11aR)-7-(methoxymethoxy)-9a,11a-dimethyl-5-oxo-2,3,3a,5a,6,7,8,9,10,11-decahydro-1H-indeno[4,5-c]isochromen-1-yl]octyl acetate |
|---|---|
| PubChem CID | 67615955 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 8-[(1R,3aR,5aS,7S,9aS,11aR)-7-(methoxymethoxy)-9a,11a-dimethyl-5-oxo-2,3,3a,5a,6,7,8,9,10,11-decahydro-1H-indeno[4,5-c]isochromen-1-yl]octyl acetate |
| SMILES | COCO[C@H]1CC[C@]2(C)C3=C(OC(=O)[C@H]2C1)[C@@H]1CC[C@@H](CCCCCCCCOC(C)=O)[C@@]1(C)CC3 |
| InChI | InChI=1S/C30H48O6/c1-21(31)34-18-10-8-6-5-7-9-11-22-12-13-24-27-25(15-17-29(22,24)2)30(3)16-14-23(35-20-33-4)19-26(30)28(32)36-27/h22-24,26H,5-20H2,1-4H3/t22-,23+,24+,26-,29-,30-/m1/s1 |
| InChIKey | QCFWDEDFNMUAQN-JLQNTOJXSA-N |
| XLogP | 6.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|