C29H29N3O6 — CID 67616092
methyl 2-ethoxy-3-[4-[2-(C-ethoxy-N-methoxycarbonylcarbonimidoyl)phenyl]phenyl]-7-methylbenzimidazole-4-carboxylate (PubChem CID 67616092) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is methyl 2-ethoxy-3-[4-[2-(C-ethoxy-N-methoxycarbonylcarbonimidoyl)phenyl]phenyl]-7-methylbenzimidazole-4-carboxylate.
| Compound Name | methyl 2-ethoxy-3-[4-[2-(C-ethoxy-N-methoxycarbonylcarbonimidoyl)phenyl]phenyl]-7-methylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 67616092 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | methyl 2-ethoxy-3-[4-[2-(C-ethoxy-N-methoxycarbonylcarbonimidoyl)phenyl]phenyl]-7-methylbenzimidazole-4-carboxylate |
| SMILES | CCOC(=NC(=O)OC)c1ccccc1-c1ccc(-n2c(OCC)nc3c(C)ccc(C(=O)OC)c32)cc1 |
| InChI | InChI=1S/C29H29N3O6/c1-6-37-26(31-29(34)36-5)22-11-9-8-10-21(22)19-13-15-20(16-14-19)32-25-23(27(33)35-4)17-12-18(3)24(25)30-28(32)38-7-2/h8-17H,6-7H2,1-5H3 |
| InChIKey | JVMFTRBFDNNWCZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|