About N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide
N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide (PubChem CID 67616179) has the molecular formula C7H8F3N3O2S
and a molecular weight of 255.22 g/mol. Its IUPAC name is N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide |
| PubChem CID | 67616179 |
| Molecular Formula | C7H8F3N3O2S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cncnc1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O2S/c1-5(7(8,9)10)13-16(14,15)6-2-11-4-12-3-6/h2-5,13H,1H3/t5-/m1/s1 |
| InChIKey | JRJYMDDLZBVUJX-RXMQYKEDSA-N |
| XLogP | 0.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
The IUPAC name of N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide (CID 67616179) is N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide.
What is the SMILES notation for N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
The canonical SMILES for N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide is C[C@@H](NS(=O)(=O)c1cncnc1)C(F)(F)F.
What is the InChIKey of N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
The InChIKey is JRJYMDDLZBVUJX-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H8F3N3O2S/c1-5(7(8,9)10)13-16(14,15)6-2-11-4-12-3-6/h2-5,13H,1H3/t5-/m1/s1.
What are the key properties of N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide?
N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide has a molecular weight of 255.22 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrimidine-5-sulfonamide is sourced from PubChem (CID 67616179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).