C8H12N2O2 — CID 67616196
1,1-diaminoethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 67616196) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,1-diaminoethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
| Compound Name | 1,1-diaminoethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 67616196 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1,1-diaminoethanol;7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | CC(N)(N)O.c1cc2ccc1o2 |
| InChI | InChI=1S/C6H4O.C2H8N2O/c1-2-6-4-3-5(1)7-6;1-2(3,4)5/h1-4H;5H,3-4H2,1H3 |
| InChIKey | FCFPPAZGHADDHH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|