About 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole
1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole (PubChem CID 67616542) has the molecular formula C22H25F2N3O3S
and a molecular weight of 449.52 g/mol. Its IUPAC name is 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole.
Molecular Properties
| Compound Name | 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole |
| PubChem CID | 67616542 |
| Molecular Formula | C22H25F2N3O3S |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole |
| SMILES | CC(F)(F)CN1CCC(Oc2ccc(-n3ccc4cc(S(C)(=O)=O)ccc43)nc2)CC1 |
| InChI | InChI=1S/C22H25F2N3O3S/c1-22(23,24)15-26-10-8-17(9-11-26)30-18-3-6-21(25-14-18)27-12-7-16-13-19(31(2,28)29)4-5-20(16)27/h3-7,12-14,17H,8-11,15H2,1-2H3 |
| InChIKey | SJFHOCJUOODYRO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole?
The IUPAC name of 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole (CID 67616542) is 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole.
What is the SMILES notation for 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole?
The canonical SMILES for 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole is CC(F)(F)CN1CCC(Oc2ccc(-n3ccc4cc(S(C)(=O)=O)ccc43)nc2)CC1.
What is the InChIKey of 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole?
The InChIKey is SJFHOCJUOODYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F2N3O3S/c1-22(23,24)15-26-10-8-17(9-11-26)30-18-3-6-21(25-14-18)27-12-7-16-13-19(31(2,28)29)4-5-20(16)27/h3-7,12-14,17H,8-11,15H2,1-2H3.
What are the key properties of 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole?
1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole has a molecular weight of 449.52 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[1-(2,2-difluoropropyl)piperidin-4-yl]oxy-2-pyridinyl]-5-methylsulfonylindole is sourced from PubChem (CID 67616542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).