C24H34Cl2N2 — CID 67616689
6-(1,2,3,6-tetrahydropyridin-4-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,2-dihydropyridine;dihydrochloride (PubChem CID 67616689) has the molecular formula C24H34Cl2N2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 6-(1,2,3,6-tetrahydropyridin-4-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,2-dihydropyridine;dihydrochloride.
| Compound Name | 6-(1,2,3,6-tetrahydropyridin-4-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,2-dihydropyridine;dihydrochloride |
|---|---|
| PubChem CID | 67616689 |
| Molecular Formula | C24H34Cl2N2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 6-(1,2,3,6-tetrahydropyridin-4-yl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,2-dihydropyridine;dihydrochloride |
| SMILES | CC1(C)CCC(C)(C)c2cc(C3=CCNC(C4=CCNCC4)=C3)ccc21.Cl.Cl |
| InChI | InChI=1S/C24H32N2.2ClH/c1-23(2)10-11-24(3,4)21-15-18(5-6-20(21)23)19-9-14-26-22(16-19)17-7-12-25-13-8-17;;/h5-7,9,15-16,25-26H,8,10-14H2,1-4H3;2*1H |
| InChIKey | AIYMSWBDIYBERN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |