C12H15NO2 — CID 67616752
2,3,4,4a,5a,6-hexahydro-1H-chromeno[3,2-c]pyridin-10-ol (PubChem CID 67616752) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,3,4,4a,5a,6-hexahydro-1H-chromeno[3,2-c]pyridin-10-ol.
| Compound Name | 2,3,4,4a,5a,6-hexahydro-1H-chromeno[3,2-c]pyridin-10-ol |
|---|---|
| PubChem CID | 67616752 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,3,4,4a,5a,6-hexahydro-1H-chromeno[3,2-c]pyridin-10-ol |
| SMILES | OC1=C2CNCCC2OC2CC=CC=C12 |
| InChI | InChI=1S/C12H15NO2/c14-12-8-3-1-2-4-10(8)15-11-5-6-13-7-9(11)12/h1-3,10-11,13-14H,4-7H2 |
| InChIKey | FHUYBKDWKUSXFL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |