C25H32O3 — CID 67616949
(2R,15S,18R,19R)-19-ethyl-7-methoxy-18-methyl-9,12-dioxahexacyclo[17.2.2.01,18.02,15.05,14.08,13]tricosa-5,7,13,20-tetraene (PubChem CID 67616949) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2R,15S,18R,19R)-19-ethyl-7-methoxy-18-methyl-9,12-dioxahexacyclo[17.2.2.01,18.02,15.05,14.08,13]tricosa-5,7,13,20-tetraene.
| Compound Name | (2R,15S,18R,19R)-19-ethyl-7-methoxy-18-methyl-9,12-dioxahexacyclo[17.2.2.01,18.02,15.05,14.08,13]tricosa-5,7,13,20-tetraene |
|---|---|
| PubChem CID | 67616949 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (2R,15S,18R,19R)-19-ethyl-7-methoxy-18-methyl-9,12-dioxahexacyclo[17.2.2.01,18.02,15.05,14.08,13]tricosa-5,7,13,20-tetraene |
| SMILES | CC[C@]12C=CC3(CC1)[C@@H]1CCc4cc(OC)c5c(c4[C@H]1CC[C@@]32C)OCCO5 |
| InChI | InChI=1S/C25H32O3/c1-4-24-9-11-25(12-10-24)18-6-5-16-15-19(26-3)21-22(28-14-13-27-21)20(16)17(18)7-8-23(24,25)2/h9,11,15,17-18H,4-8,10,12-14H2,1-3H3/t17-,18+,23+,24-,25?/m0/s1 |
| InChIKey | WGTTVFTVBMLKGV-HLVJVMOASA-N |
| XLogP | 5.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|