About 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one
3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one (PubChem CID 67617276) has the molecular formula C23H17F3N2O2
and a molecular weight of 410.40 g/mol. Its IUPAC name is 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one |
| PubChem CID | 67617276 |
| Molecular Formula | C23H17F3N2O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1c(-c2ccc(Cc3ccc(OC(F)(F)F)cc3)cc2)[nH]c2ncccc2c1=O |
| InChI | InChI=1S/C23H17F3N2O2/c1-14-20(28-22-19(21(14)29)3-2-12-27-22)17-8-4-15(5-9-17)13-16-6-10-18(11-7-16)30-23(24,25)26/h2-12H,13H2,1H3,(H,27,28,29) |
| InChIKey | CPYQEWIUVUICCV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one?
The IUPAC name of 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one (CID 67617276) is 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one is Cc1c(-c2ccc(Cc3ccc(OC(F)(F)F)cc3)cc2)[nH]c2ncccc2c1=O.
What is the InChIKey of 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one?
The InChIKey is CPYQEWIUVUICCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F3N2O2/c1-14-20(28-22-19(21(14)29)3-2-12-27-22)17-8-4-15(5-9-17)13-16-6-10-18(11-7-16)30-23(24,25)26/h2-12H,13H2,1H3,(H,27,28,29).
What are the key properties of 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one?
3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one has a molecular weight of 410.40 g/mol, XLogP of 5.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 67617276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).