C23H15ClF3NO2 — CID 67617538
3-chloro-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-quinolin-4-one (PubChem CID 67617538) has the molecular formula C23H15ClF3NO2 and a molecular weight of 429.83 g/mol. Its IUPAC name is 3-chloro-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-quinolin-4-one.
| Compound Name | 3-chloro-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 67617538 |
| Molecular Formula | C23H15ClF3NO2 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 3-chloro-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]-1H-quinolin-4-one |
| SMILES | O=c1c(Cl)c(-c2ccc(Cc3ccc(OC(F)(F)F)cc3)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H15ClF3NO2/c24-20-21(28-19-4-2-1-3-18(19)22(20)29)16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)30-23(25,26)27/h1-12H,13H2,(H,28,29) |
| InChIKey | JUOYHJPAYQNMCS-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |