C17H30N2O3 — CID 67617562
1-[3-[3-(2-oxopiperidin-1-yl)propoxy]propyl]azepan-2-one (PubChem CID 67617562) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[3-[3-(2-oxopiperidin-1-yl)propoxy]propyl]azepan-2-one.
| Compound Name | 1-[3-[3-(2-oxopiperidin-1-yl)propoxy]propyl]azepan-2-one |
|---|---|
| PubChem CID | 67617562 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-[3-[3-(2-oxopiperidin-1-yl)propoxy]propyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCCOCCCN1CCCCC1=O |
| InChI | InChI=1S/C17H30N2O3/c20-16-8-2-1-4-10-18(16)12-6-14-22-15-7-13-19-11-5-3-9-17(19)21/h1-15H2 |
| InChIKey | LYNKBDWYAIJVSE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|