C30H36N6O4Si — CID 67619117
benzyl (3S)-3-[[3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridine-2-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 67619117) has the molecular formula C30H36N6O4Si and a molecular weight of 572.74 g/mol. Its IUPAC name is benzyl (3S)-3-[[3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridine-2-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[[3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridine-2-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67619117 |
| Molecular Formula | C30H36N6O4Si |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | benzyl (3S)-3-[[3-[5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]pyridine-2-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(-c3cccnc3C(=O)N[C@H]3CCN(C(=O)OCc4ccccc4)C3)cnc21 |
| InChI | InChI=1S/C30H36N6O4Si/c1-41(2,3)17-16-39-21-36-15-12-25-28(36)32-18-26(34-25)24-10-7-13-31-27(24)29(37)33-23-11-14-35(19-23)30(38)40-20-22-8-5-4-6-9-22/h4-10,12-13,15,18,23H,11,14,16-17,19-21H2,1-3H3,(H,33,37)/t23-/m0/s1 |
| InChIKey | XGGFMTPNBUTWIT-QHCPKHFHSA-N |
| XLogP | 4.95 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|