C29H33NO — CID 67619119
(8R,9S,10R,13S,14S)-13-methyl-2-(4-pyridin-3-ylphenyl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 67619119) has the molecular formula C29H33NO and a molecular weight of 411.59 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-13-methyl-2-(4-pyridin-3-ylphenyl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-13-methyl-2-(4-pyridin-3-ylphenyl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67619119 |
| Molecular Formula | C29H33NO |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | (8R,9S,10R,13S,14S)-13-methyl-2-(4-pyridin-3-ylphenyl)-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(c4ccc(-c5cccnc5)cc4)C[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C29H33NO/c1-29-13-2-5-27(29)24-11-10-21-16-28(31)26(17-25(21)23(24)12-14-29)20-8-6-19(7-9-20)22-4-3-15-30-18-22/h3-4,6-9,15-16,18,23-27H,2,5,10-14,17H2,1H3/t23-,24+,25-,26?,27-,29-/m0/s1 |
| InChIKey | NWLGZCHJUDCMJF-YWYSURPKSA-N |
| XLogP | 6.97 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |