C25H26N6O2 — CID 67619193
[1-[methyl(pyridin-4-yl)amino]indol-5-yl]-(4-phenylpiperazin-1-yl)carbamic acid (PubChem CID 67619193) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is [1-[methyl(pyridin-4-yl)amino]indol-5-yl]-(4-phenylpiperazin-1-yl)carbamic acid.
| Compound Name | [1-[methyl(pyridin-4-yl)amino]indol-5-yl]-(4-phenylpiperazin-1-yl)carbamic acid |
|---|---|
| PubChem CID | 67619193 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [1-[methyl(pyridin-4-yl)amino]indol-5-yl]-(4-phenylpiperazin-1-yl)carbamic acid |
| SMILES | CN(c1ccncc1)n1ccc2cc(N(C(=O)O)N3CCN(c4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C25H26N6O2/c1-27(21-9-12-26-13-10-21)30-14-11-20-19-23(7-8-24(20)30)31(25(32)33)29-17-15-28(16-18-29)22-5-3-2-4-6-22/h2-14,19H,15-18H2,1H3,(H,32,33) |
| InChIKey | BJJBTSKUDRAROF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |